C18H31NO3 — CID 95421402
3-(2,3,4-tripropoxyphenyl)propan-1-amine (PubChem CID 95421402) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-(2,3,4-tripropoxyphenyl)propan-1-amine.
| Compound Name | 3-(2,3,4-tripropoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 95421402 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-(2,3,4-tripropoxyphenyl)propan-1-amine |
| SMILES | CCCOc1ccc(CCCN)c(OCCC)c1OCCC |
| InChI | InChI=1S/C18H31NO3/c1-4-12-20-16-10-9-15(8-7-11-19)17(21-13-5-2)18(16)22-14-6-3/h9-10H,4-8,11-14,19H2,1-3H3 |
| InChIKey | CLRDEIZWMTZGFS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |