C20H32O3 — CID 83934194
1-(2-methylbut-3-enyl)-2,3,4-tripropoxybenzene (PubChem CID 83934194) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-(2-methylbut-3-enyl)-2,3,4-tripropoxybenzene.
| Compound Name | 1-(2-methylbut-3-enyl)-2,3,4-tripropoxybenzene |
|---|---|
| PubChem CID | 83934194 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1-(2-methylbut-3-enyl)-2,3,4-tripropoxybenzene |
| SMILES | C=CC(C)Cc1ccc(OCCC)c(OCCC)c1OCCC |
| InChI | InChI=1S/C20H32O3/c1-6-12-21-18-11-10-17(15-16(5)9-4)19(22-13-7-2)20(18)23-14-8-3/h9-11,16H,4,6-8,12-15H2,1-3,5H3 |
| InChIKey | GTDWFLHOQKVTMZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|