C17H24O3 — CID 141200812
1-ethoxy-2,3-bis(prop-2-enoxy)-4-propylbenzene (PubChem CID 141200812) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-ethoxy-2,3-bis(prop-2-enoxy)-4-propylbenzene.
| Compound Name | 1-ethoxy-2,3-bis(prop-2-enoxy)-4-propylbenzene |
|---|---|
| PubChem CID | 141200812 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-ethoxy-2,3-bis(prop-2-enoxy)-4-propylbenzene |
| SMILES | C=CCOc1c(CCC)ccc(OCC)c1OCC=C |
| InChI | InChI=1S/C17H24O3/c1-5-9-14-10-11-15(18-8-4)17(20-13-7-3)16(14)19-12-6-2/h6-7,10-11H,2-3,5,8-9,12-13H2,1,4H3 |
| InChIKey | CUILYAZBJGKIDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|