C17H25N3O3 — CID 112718810
1-methyl-4-[2-(2,3,4-triethoxyphenyl)ethyl]triazole (PubChem CID 112718810) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-methyl-4-[2-(2,3,4-triethoxyphenyl)ethyl]triazole.
| Compound Name | 1-methyl-4-[2-(2,3,4-triethoxyphenyl)ethyl]triazole |
|---|---|
| PubChem CID | 112718810 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-methyl-4-[2-(2,3,4-triethoxyphenyl)ethyl]triazole |
| SMILES | CCOc1ccc(CCc2cn(C)nn2)c(OCC)c1OCC |
| InChI | InChI=1S/C17H25N3O3/c1-5-21-15-11-9-13(8-10-14-12-20(4)19-18-14)16(22-6-2)17(15)23-7-3/h9,11-12H,5-8,10H2,1-4H3 |
| InChIKey | PJKNOOPSKRKGOB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |