C13H15Cl2N3O — CID 112719478
4-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]-1-methyltriazole (PubChem CID 112719478) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 4-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]-1-methyltriazole.
| Compound Name | 4-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]-1-methyltriazole |
|---|---|
| PubChem CID | 112719478 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]-1-methyltriazole |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CCc1cn(C)nn1 |
| InChI | InChI=1S/C13H15Cl2N3O/c1-3-19-13-9(6-10(14)7-12(13)15)4-5-11-8-18(2)17-16-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | FUFIZGGWZROBCV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |