C16H26NO2+ — CID 7993578
[(2S)-butan-2-yl]-[(3-ethoxy-2-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7993578) has the molecular formula C16H26NO2+ and a molecular weight of 264.39 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[(3-ethoxy-2-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | [(2S)-butan-2-yl]-[(3-ethoxy-2-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7993578 |
| Molecular Formula | C16H26NO2+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | [(2S)-butan-2-yl]-[(3-ethoxy-2-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1c(C[NH2+][C@@H](C)CC)cccc1OCC |
| InChI | InChI=1S/C16H25NO2/c1-5-11-19-16-14(12-17-13(4)6-2)9-8-10-15(16)18-7-3/h5,8-10,13,17H,1,6-7,11-12H2,2-4H3/p+1/t13-/m0/s1 |
| InChIKey | ZWFUXNJVYHBCSQ-ZDUSSCGKSA-O |
| XLogP | 2.51 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|