About 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride
4-prop-2-enoxy-3,5-dipropylbenzoyl chloride (PubChem CID 125469452) has the molecular formula C16H21ClO2
and a molecular weight of 280.79 g/mol. Its IUPAC name is 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride |
| PubChem CID | 125469452 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.79 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride |
| SMILES | C=CCOc1c(CCC)cc(C(=O)Cl)cc1CCC |
| InChI | InChI=1S/C16H21ClO2/c1-4-7-12-10-14(16(17)18)11-13(8-5-2)15(12)19-9-6-3/h6,10-11H,3-5,7-9H2,1-2H3 |
| InChIKey | WWTJETZTBCWBMT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride?
The IUPAC name of 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride (CID 125469452) is 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride.
What is the SMILES notation for 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride?
The canonical SMILES for 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride is C=CCOc1c(CCC)cc(C(=O)Cl)cc1CCC.
What is the InChIKey of 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride?
The InChIKey is WWTJETZTBCWBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClO2/c1-4-7-12-10-14(16(17)18)11-13(8-5-2)15(12)19-9-6-3/h6,10-11H,3-5,7-9H2,1-2H3.
What are the key properties of 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride?
4-prop-2-enoxy-3,5-dipropylbenzoyl chloride has a molecular weight of 280.79 g/mol, XLogP of 4.54, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoxy-3,5-dipropylbenzoyl chloride is sourced from PubChem (CID 125469452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).