C16H18O3 — CID 23459774
8-methyl-7-prop-2-enoxy-4-propylchromen-2-one (PubChem CID 23459774) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 8-methyl-7-prop-2-enoxy-4-propylchromen-2-one.
| Compound Name | 8-methyl-7-prop-2-enoxy-4-propylchromen-2-one |
|---|---|
| PubChem CID | 23459774 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 8-methyl-7-prop-2-enoxy-4-propylchromen-2-one |
| SMILES | C=CCOc1ccc2c(CCC)cc(=O)oc2c1C |
| InChI | InChI=1S/C16H18O3/c1-4-6-12-10-15(17)19-16-11(3)14(18-9-5-2)8-7-13(12)16/h5,7-8,10H,2,4,6,9H2,1,3H3 |
| InChIKey | UPPNCUIYVJLKNF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|