C22H22O3 — CID 2299144
8-methyl-7-[(E)-3-phenylprop-2-enoxy]-4-propylchromen-2-one (PubChem CID 2299144) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 8-methyl-7-[(E)-3-phenylprop-2-enoxy]-4-propylchromen-2-one.
| Compound Name | 8-methyl-7-[(E)-3-phenylprop-2-enoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 2299144 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 8-methyl-7-[(E)-3-phenylprop-2-enoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(C)c(OC/C=C/c3ccccc3)ccc12 |
| InChI | InChI=1S/C22H22O3/c1-3-8-18-15-21(23)25-22-16(2)20(13-12-19(18)22)24-14-7-11-17-9-5-4-6-10-17/h4-7,9-13,15H,3,8,14H2,1-2H3/b11-7+ |
| InChIKey | IYJPZUVOBVYQAK-YRNVUSSQSA-N |
| XLogP | 5.15 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|