C20H28O6 — CID 18935688
(2,3-diethoxy-4-propylphenyl) prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 18935688) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2,3-diethoxy-4-propylphenyl) prop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | (2,3-diethoxy-4-propylphenyl) prop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 18935688 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (2,3-diethoxy-4-propylphenyl) prop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)Oc1ccc(CCC)c(OCC)c1OCC |
| InChI | InChI=1S/C16H22O4.C4H6O2/c1-5-9-12-10-11-13(20-14(17)6-2)16(19-8-4)15(12)18-7-3;1-3(2)4(5)6/h6,10-11H,2,5,7-9H2,1,3-4H3;1H2,2H3,(H,5,6) |
| InChIKey | DNNVINOOMYXKFT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|