C19H28O4 — CID 174604122
(2-methyl-3,4-dipropoxy-5-propylphenyl) prop-2-enoate (PubChem CID 174604122) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2-methyl-3,4-dipropoxy-5-propylphenyl) prop-2-enoate.
| Compound Name | (2-methyl-3,4-dipropoxy-5-propylphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 174604122 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2-methyl-3,4-dipropoxy-5-propylphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(CCC)c(OCCC)c(OCCC)c1C |
| InChI | InChI=1S/C19H28O4/c1-6-10-15-13-16(23-17(20)9-4)14(5)18(21-11-7-2)19(15)22-12-8-3/h9,13H,4,6-8,10-12H2,1-3,5H3 |
| InChIKey | GFQUHTANQMNWRA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|