C9H10O4 — CID 44887021
4-ethoxy-2,3-dihydroxybenzaldehyde (PubChem CID 44887021) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-ethoxy-2,3-dihydroxybenzaldehyde.
| Compound Name | 4-ethoxy-2,3-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 44887021 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4-ethoxy-2,3-dihydroxybenzaldehyde |
| SMILES | CCOc1ccc(C=O)c(O)c1O |
| InChI | InChI=1S/C9H10O4/c1-2-13-7-4-3-6(5-10)8(11)9(7)12/h3-5,11-12H,2H2,1H3 |
| InChIKey | WOSWBATZOUYEOH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|