C11H14O4 — CID 22039093
4,5-diethoxy-2-hydroxybenzaldehyde (PubChem CID 22039093) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4,5-diethoxy-2-hydroxybenzaldehyde.
| Compound Name | 4,5-diethoxy-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 22039093 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4,5-diethoxy-2-hydroxybenzaldehyde |
| SMILES | CCOc1cc(O)c(C=O)cc1OCC |
| InChI | InChI=1S/C11H14O4/c1-3-14-10-5-8(7-12)9(13)6-11(10)15-4-2/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | DEMKNCFRRLVKPM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|