3-ethoxy-4-hydroxybenzaldehyde;formic acid

C10H12O5 — CID 175904717

IUPAC3-ethoxy-4-hydroxybenzaldehyde;formic acid
SMILESCCOc1cc(C=O)ccc1O.O=CO
InChIInChI=1S/C9H10O3.CH2O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;2-1-3/h3-6,11H,2H2,1H3;1H,(H,2,3)
InChIKeyLZJKONSACMRYBY-UHFFFAOYSA-N
MW212.20 g/mol
LogP1.30
Rot. Bonds3

About 3-ethoxy-4-hydroxybenzaldehyde;formic acid

3-ethoxy-4-hydroxybenzaldehyde;formic acid (PubChem CID 175904717) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-ethoxy-4-hydroxybenzaldehyde;formic acid.

Molecular Properties

Compound Name3-ethoxy-4-hydroxybenzaldehyde;formic acid
PubChem CID175904717
Molecular FormulaC10H12O5
Molecular Weight212.20 g/mol
Exact Mass212.07
IUPAC Name3-ethoxy-4-hydroxybenzaldehyde;formic acid
SMILESCCOc1cc(C=O)ccc1O.O=CO
InChIInChI=1S/C9H10O3.CH2O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;2-1-3/h3-6,11H,2H2,1H3;1H,(H,2,3)
InChIKeyLZJKONSACMRYBY-UHFFFAOYSA-N
XLogP1.30
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 3-ethoxy-4-hydroxybenzaldehyde;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethoxy-4-hydroxybenzaldehyde;formic acid?
The IUPAC name of 3-ethoxy-4-hydroxybenzaldehyde;formic acid (CID 175904717) is 3-ethoxy-4-hydroxybenzaldehyde;formic acid.
What is the SMILES notation for 3-ethoxy-4-hydroxybenzaldehyde;formic acid?
The canonical SMILES for 3-ethoxy-4-hydroxybenzaldehyde;formic acid is CCOc1cc(C=O)ccc1O.O=CO.
What is the InChIKey of 3-ethoxy-4-hydroxybenzaldehyde;formic acid?
The InChIKey is LZJKONSACMRYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.CH2O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;2-1-3/h3-6,11H,2H2,1H3;1H,(H,2,3).
What are the key properties of 3-ethoxy-4-hydroxybenzaldehyde;formic acid?
3-ethoxy-4-hydroxybenzaldehyde;formic acid has a molecular weight of 212.20 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4-hydroxybenzaldehyde;formic acid is sourced from PubChem (CID 175904717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).