C13H16O5 — CID 174907200
but-3-enoic acid;3-ethoxy-4-hydroxybenzaldehyde (PubChem CID 174907200) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is but-3-enoic acid;3-ethoxy-4-hydroxybenzaldehyde.
| Compound Name | but-3-enoic acid;3-ethoxy-4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 174907200 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | but-3-enoic acid;3-ethoxy-4-hydroxybenzaldehyde |
| SMILES | C=CCC(=O)O.CCOc1cc(C=O)ccc1O |
| InChI | InChI=1S/C9H10O3.C4H6O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;1-2-3-4(5)6/h3-6,11H,2H2,1H3;2H,1,3H2,(H,5,6) |
| InChIKey | QAPSHKYFLLRQIJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|