C19H25NO6 — CID 88605667
4-ethoxyaniline;4-hydroxy-3-methoxybenzaldehyde;propanoic acid (PubChem CID 88605667) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-ethoxyaniline;4-hydroxy-3-methoxybenzaldehyde;propanoic acid.
| Compound Name | 4-ethoxyaniline;4-hydroxy-3-methoxybenzaldehyde;propanoic acid |
|---|---|
| PubChem CID | 88605667 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-ethoxyaniline;4-hydroxy-3-methoxybenzaldehyde;propanoic acid |
| SMILES | CCC(=O)O.CCOc1ccc(N)cc1.COc1cc(C=O)ccc1O |
| InChI | InChI=1S/C8H11NO.C8H8O3.C3H6O2/c1-2-10-8-5-3-7(9)4-6-8;1-11-8-4-6(5-9)2-3-7(8)10;1-2-3(4)5/h3-6H,2,9H2,1H3;2-5,10H,1H3;2H2,1H3,(H,4,5) |
| InChIKey | FUNWWHGKEFSLOQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|