About 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol
3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol (PubChem CID 175369176) has the molecular formula C18H22O5
and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol.
Molecular Properties
| Compound Name | 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol |
| PubChem CID | 175369176 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol |
| SMILES | CCOc1cc(C=O)ccc1O.CCOc1ccc(CO)cc1 |
| InChI | InChI=1S/C9H10O3.C9H12O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;1-2-11-9-5-3-8(7-10)4-6-9/h3-6,11H,2H2,1H3;3-6,10H,2,7H2,1H3 |
| InChIKey | OLHJUQSBUODUGN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol?
The IUPAC name of 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol (CID 175369176) is 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol.
What is the SMILES notation for 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol?
The canonical SMILES for 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol is CCOc1cc(C=O)ccc1O.CCOc1ccc(CO)cc1.
What is the InChIKey of 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol?
The InChIKey is OLHJUQSBUODUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C9H12O2/c1-2-12-9-5-7(6-10)3-4-8(9)11;1-2-11-9-5-3-8(7-10)4-6-9/h3-6,11H,2H2,1H3;3-6,10H,2,7H2,1H3.
What are the key properties of 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol?
3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol has a molecular weight of 318.37 g/mol, XLogP of 3.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4-hydroxybenzaldehyde;(4-ethoxyphenyl)methanol is sourced from PubChem (CID 175369176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).