C15H16O4 — CID 159645341
benzaldehyde;2-ethoxybenzene-1,4-diol (PubChem CID 159645341) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is benzaldehyde;2-ethoxybenzene-1,4-diol.
| Compound Name | benzaldehyde;2-ethoxybenzene-1,4-diol |
|---|---|
| PubChem CID | 159645341 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | benzaldehyde;2-ethoxybenzene-1,4-diol |
| SMILES | CCOc1cc(O)ccc1O.O=Cc1ccccc1 |
| InChI | InChI=1S/C8H10O3.C7H6O/c1-2-11-8-5-6(9)3-4-7(8)10;8-6-7-4-2-1-3-5-7/h3-5,9-10H,2H2,1H3;1-6H |
| InChIKey | MQWRMGMZQNBECC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|