About 4-amino-2-ethoxyphenol
4-amino-2-ethoxyphenol (PubChem CID 12856010) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-amino-2-ethoxyphenol.
Molecular Properties
| Compound Name | 4-amino-2-ethoxyphenol |
| PubChem CID | 12856010 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-amino-2-ethoxyphenol |
| SMILES | CCOc1cc(N)ccc1O |
| InChI | InChI=1S/C8H11NO2/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5,10H,2,9H2,1H3 |
| InChIKey | VCYQNCHWCSKOTO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-ethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-ethoxyphenol?
The IUPAC name of 4-amino-2-ethoxyphenol (CID 12856010) is 4-amino-2-ethoxyphenol.
What is the SMILES notation for 4-amino-2-ethoxyphenol?
The canonical SMILES for 4-amino-2-ethoxyphenol is CCOc1cc(N)ccc1O.
What is the InChIKey of 4-amino-2-ethoxyphenol?
The InChIKey is VCYQNCHWCSKOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5,10H,2,9H2,1H3.
What are the key properties of 4-amino-2-ethoxyphenol?
4-amino-2-ethoxyphenol has a molecular weight of 153.18 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-ethoxyphenol is sourced from PubChem (CID 12856010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).