About 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide
2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide (PubChem CID 59395610) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide |
| PubChem CID | 59395610 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide |
| SMILES | CCOc1cc(C/C(N)=N/O)ccc1O |
| InChI | InChI=1S/C10H14N2O3/c1-2-15-9-5-7(3-4-8(9)13)6-10(11)12-14/h3-5,13-14H,2,6H2,1H3,(H2,11,12) |
| InChIKey | GDLPNUZYSAZFSB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide (CID 59395610) is 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide is CCOc1cc(C/C(N)=N/O)ccc1O.
What is the InChIKey of 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide?
The InChIKey is GDLPNUZYSAZFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-2-15-9-5-7(3-4-8(9)13)6-10(11)12-14/h3-5,13-14H,2,6H2,1H3,(H2,11,12).
What are the key properties of 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide?
2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide has a molecular weight of 210.23 g/mol, XLogP of 1.08, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethoxy-4-hydroxyphenyl)-N'-hydroxyethanimidamide is sourced from PubChem (CID 59395610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).