C39H52O14 — CID 160989703
3-[2-[5-[2-(5-formyl-2-hydroxyphenoxy)ethoxy]pentoxy]ethoxy]-4-hydroxybenzaldehyde;4-hydroxy-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]benzaldehyde (PubChem CID 160989703) has the molecular formula C39H52O14 and a molecular weight of 744.83 g/mol. Its IUPAC name is 3-[2-[5-[2-(5-formyl-2-hydroxyphenoxy)ethoxy]pentoxy]ethoxy]-4-hydroxybenzaldehyde;4-hydroxy-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]benzaldehyde.
| Compound Name | 3-[2-[5-[2-(5-formyl-2-hydroxyphenoxy)ethoxy]pentoxy]ethoxy]-4-hydroxybenzaldehyde;4-hydroxy-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 160989703 |
| Molecular Formula | C39H52O14 |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | 3-[2-[5-[2-(5-formyl-2-hydroxyphenoxy)ethoxy]pentoxy]ethoxy]-4-hydroxybenzaldehyde;4-hydroxy-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]benzaldehyde |
| SMILES | CCCOCCOCCOCCOc1cc(C=O)ccc1O.O=Cc1ccc(O)c(OCCOCCCCCOCCOc2cc(C=O)ccc2O)c1 |
| InChI | InChI=1S/C23H28O8.C16H24O6/c24-16-18-4-6-20(26)22(14-18)30-12-10-28-8-2-1-3-9-29-11-13-31-23-15-19(17-25)5-7-21(23)27;1-2-5-19-6-7-20-8-9-21-10-11-22-16-12-14(13-17)3-4-15(16)18/h4-7,14-17,26-27H,1-3,8-13H2;3-4,12-13,18H,2,5-11H2,1H3 |
| InChIKey | TULOOEZRQKRBNJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 185.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|