C13H20O2 — CID 162375052
4-ethoxy-2,6-diethyl-3-methylphenol (PubChem CID 162375052) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-ethoxy-2,6-diethyl-3-methylphenol.
| Compound Name | 4-ethoxy-2,6-diethyl-3-methylphenol |
|---|---|
| PubChem CID | 162375052 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-ethoxy-2,6-diethyl-3-methylphenol |
| SMILES | CCOc1cc(CC)c(O)c(CC)c1C |
| InChI | InChI=1S/C13H20O2/c1-5-10-8-12(15-7-3)9(4)11(6-2)13(10)14/h8,14H,5-7H2,1-4H3 |
| InChIKey | POZQAAAFXUDBJV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |