C9H9BrF2O3 — CID 107140464
5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxyphenol (PubChem CID 107140464) has the molecular formula C9H9BrF2O3 and a molecular weight of 283.07 g/mol. Its IUPAC name is 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxyphenol.
| Compound Name | 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxyphenol |
|---|---|
| PubChem CID | 107140464 |
| Molecular Formula | C9H9BrF2O3 |
| Molecular Weight | 283.07 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxyphenol |
| SMILES | COc1ccc(C(O)C(F)(F)Br)cc1O |
| InChI | InChI=1S/C9H9BrF2O3/c1-15-7-3-2-5(4-6(7)13)8(14)9(10,11)12/h2-4,8,13-14H,1H3 |
| InChIKey | MTSOBUVXTPGLOO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|