C10H12O5 — CID 94425310
(3S)-3-hydroxy-3-(3-hydroxy-4-methoxyphenyl)propanoic acid (PubChem CID 94425310) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-(3-hydroxy-4-methoxyphenyl)propanoic acid.
| Compound Name | (3S)-3-hydroxy-3-(3-hydroxy-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 94425310 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (3S)-3-hydroxy-3-(3-hydroxy-4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@@H](O)CC(=O)O)cc1O |
| InChI | InChI=1S/C10H12O5/c1-15-9-3-2-6(4-8(9)12)7(11)5-10(13)14/h2-4,7,11-12H,5H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | JEXBTMWMYGBBHO-ZETCQYMHSA-N |
| XLogP | 0.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |