C13H18O5S — CID 23778546
[(4S)-4-hydroxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate (PubChem CID 23778546) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is [(4S)-4-hydroxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate.
| Compound Name | [(4S)-4-hydroxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23778546 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(4S)-4-hydroxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate |
| SMILES | COc1ccc([C@@H](O)CCCOC(=O)CS)cc1O |
| InChI | InChI=1S/C13H18O5S/c1-17-12-5-4-9(7-11(12)15)10(14)3-2-6-18-13(16)8-19/h4-5,7,10,14-15,19H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | QJTSAKBVXXYNJD-JTQLQIEISA-N |
| XLogP | 1.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|