C13H17FO4S — CID 23976320
[(3S,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate (PubChem CID 23976320) has the molecular formula C13H17FO4S and a molecular weight of 288.34 g/mol. Its IUPAC name is [(3S,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate.
| Compound Name | [(3S,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23976320 |
| Molecular Formula | C13H17FO4S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [(3S,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate |
| SMILES | C[C@@H](CCOC(=O)CS)[C@@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C13H17FO4S/c1-8(4-5-18-12(16)7-19)13(17)9-2-3-11(15)10(14)6-9/h2-3,6,8,13,15,17,19H,4-5,7H2,1H3/t8-,13+/m0/s1 |
| InChIKey | PAIDHVDAFRFHRB-ISVAXAHUSA-N |
| XLogP | 2.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|