C26H26FNO6S2 — CID 23948568
[(3R,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-[(4-methylsulfanylphenyl)carbamoyloxy]-3-phenoxybutyl] 2-sulfanylacetate (PubChem CID 23948568) has the molecular formula C26H26FNO6S2 and a molecular weight of 531.63 g/mol. Its IUPAC name is [(3R,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-[(4-methylsulfanylphenyl)carbamoyloxy]-3-phenoxybutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-[(4-methylsulfanylphenyl)carbamoyloxy]-3-phenoxybutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23948568 |
| Molecular Formula | C26H26FNO6S2 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | [(3R,4R)-4-(3-fluoro-4-hydroxyphenyl)-4-[(4-methylsulfanylphenyl)carbamoyloxy]-3-phenoxybutyl] 2-sulfanylacetate |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2ccc(O)c(F)c2)[C@@H](CCOC(=O)CS)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26FNO6S2/c1-36-20-10-8-18(9-11-20)28-26(31)34-25(17-7-12-22(29)21(27)15-17)23(13-14-32-24(30)16-35)33-19-5-3-2-4-6-19/h2-12,15,23,25,29,35H,13-14,16H2,1H3,(H,28,31)/t23-,25-/m1/s1 |
| InChIKey | HJGYFGHSXVYJTK-ILBGXUMGSA-N |
| XLogP | 5.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|