C27H29NO7S — CID 23836803
[(3R,4R)-4-[3-(2-hydroxyethoxy)phenyl]-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23836803) has the molecular formula C27H29NO7S and a molecular weight of 511.60 g/mol. Its IUPAC name is [(3R,4R)-4-[3-(2-hydroxyethoxy)phenyl]-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[3-(2-hydroxyethoxy)phenyl]-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23836803 |
| Molecular Formula | C27H29NO7S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [(3R,4R)-4-[3-(2-hydroxyethoxy)phenyl]-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | O=C(CS)OCC[C@@H](Oc1ccccc1)[C@H](OC(=O)Nc1ccccc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C27H29NO7S/c29-15-17-32-23-13-7-8-20(18-23)26(35-27(31)28-21-9-3-1-4-10-21)24(14-16-33-25(30)19-36)34-22-11-5-2-6-12-22/h1-13,18,24,26,29,36H,14-17,19H2,(H,28,31)/t24-,26-/m1/s1 |
| InChIKey | JQZKABAFEJZZJH-AOYPEHQESA-N |
| XLogP | 4.66 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|