C28H29NO7 — CID 23948948
(E,6S,7S)-7-[4-(2-hydroxyethoxy)phenyl]-6-phenoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid (PubChem CID 23948948) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is (E,6S,7S)-7-[4-(2-hydroxyethoxy)phenyl]-6-phenoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-[4-(2-hydroxyethoxy)phenyl]-6-phenoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 23948948 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (E,6S,7S)-7-[4-(2-hydroxyethoxy)phenyl]-6-phenoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CC[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H29NO7/c30-19-20-34-23-17-15-21(16-18-23)27(36-28(33)29-22-9-3-1-4-10-22)25(13-7-8-14-26(31)32)35-24-11-5-2-6-12-24/h1-6,8-12,14-18,25,27,30H,7,13,19-20H2,(H,29,33)(H,31,32)/b14-8+/t25-,27-/m0/s1 |
| InChIKey | SYOWEZHLTSRZGS-MWMWPLPYSA-N |
| XLogP | 5.22 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|