C27H25NO7 — CID 23836683
(E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(4-hydroxyphenyl)-6-phenoxyhept-2-enoic acid (PubChem CID 23836683) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(4-hydroxyphenyl)-6-phenoxyhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(4-hydroxyphenyl)-6-phenoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23836683 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (E,6S,7S)-7-(benzoylcarbamoyloxy)-7-(4-hydroxyphenyl)-6-phenoxyhept-2-enoic acid |
| SMILES | O=C(O)/C=C/CC[C@H](Oc1ccccc1)[C@@H](OC(=O)NC(=O)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H25NO7/c29-21-17-15-19(16-18-21)25(35-27(33)28-26(32)20-9-3-1-4-10-20)23(13-7-8-14-24(30)31)34-22-11-5-2-6-12-22/h1-6,8-12,14-18,23,25,29H,7,13H2,(H,30,31)(H,28,32,33)/b14-8+/t23-,25-/m0/s1 |
| InChIKey | QFIVXOZPCPZNGO-WMCFFSSISA-N |
| XLogP | 4.87 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|