C25H25NO5 — CID 23892722
(E,6S,7S)-7-(4-hydroxyphenyl)-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid (PubChem CID 23892722) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (E,6S,7S)-7-(4-hydroxyphenyl)-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(4-hydroxyphenyl)-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 23892722 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (E,6S,7S)-7-(4-hydroxyphenyl)-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid |
| SMILES | C[C@@H](CC/C=C/C(=O)O)[C@H](OC(=O)Nc1cccc2ccccc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-17(7-2-5-12-23(28)29)24(19-13-15-20(27)16-14-19)31-25(30)26-22-11-6-9-18-8-3-4-10-21(18)22/h3-6,8-17,24,27H,2,7H2,1H3,(H,26,30)(H,28,29)/b12-5+/t17-,24-/m0/s1 |
| InChIKey | SHGSZHZZONLIIT-LSLCQJCLSA-N |
| XLogP | 5.89 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|