C25H25FN2O5 — CID 23948583
[(E,1R,2S)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate (PubChem CID 23948583) has the molecular formula C25H25FN2O5 and a molecular weight of 452.48 g/mol. Its IUPAC name is [(E,1R,2S)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E,1R,2S)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23948583 |
| Molecular Formula | C25H25FN2O5 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(E,1R,2S)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
| SMILES | C[C@@H](CC/C=C/C(=O)NO)[C@@H](OC(=O)Nc1cccc2ccccc12)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C25H25FN2O5/c1-16(7-2-5-12-23(30)28-32)24(18-13-14-22(29)20(26)15-18)33-25(31)27-21-11-6-9-17-8-3-4-10-19(17)21/h3-6,8-16,24,29,32H,2,7H2,1H3,(H,27,31)(H,28,30)/b12-5+/t16-,24+/m0/s1 |
| InChIKey | NZBDRVXBEZESJD-FGQICBFFSA-N |
| XLogP | 5.45 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|