C23H26N2O7 — CID 23976369
[(E,1R,2R)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23976369) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is [(E,1R,2R)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23976369 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [(E,1R,2R)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | COc1ccc([C@H](OC(=O)NC(=O)c2ccccc2)[C@H](C)CC/C=C/C(=O)NO)cc1O |
| InChI | InChI=1S/C23H26N2O7/c1-15(8-6-7-11-20(27)25-30)21(17-12-13-19(31-2)18(26)14-17)32-23(29)24-22(28)16-9-4-3-5-10-16/h3-5,7,9-15,21,26,30H,6,8H2,1-2H3,(H,25,27)(H,24,28,29)/b11-7+/t15-,21-/m1/s1 |
| InChIKey | NCIYPJAAENTINC-HMZPONFTSA-N |
| XLogP | 3.49 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|