C23H26N2O8 — CID 23920416
[(E,1S,2S)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23920416) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is [(E,1S,2S)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1S,2S)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23920416 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [(E,1S,2S)-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc3c(c2)OCO3)[C@@H](C)CC/C=C/C(=O)NO)cc1O |
| InChI | InChI=1S/C23H26N2O8/c1-14(5-3-4-6-21(27)25-29)22(15-7-9-18(30-2)17(26)11-15)33-23(28)24-16-8-10-19-20(12-16)32-13-31-19/h4,6-12,14,22,26,29H,3,5,13H2,1-2H3,(H,24,28)(H,25,27)/b6-4+/t14-,22-/m0/s1 |
| InChIKey | PCKSIOMGJNWXSK-XXCHNGAQSA-N |
| XLogP | 3.90 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|