C22H24N2O9 — CID 23807625
[(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23807625) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23807625 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | CCO[C@H](/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C22H24N2O9/c1-3-30-18(8-9-20(26)24-28)21(13-4-6-16(29-2)15(25)10-13)33-22(27)23-14-5-7-17-19(11-14)32-12-31-17/h4-11,18,21,25,28H,3,12H2,1-2H3,(H,23,27)(H,24,26)/b9-8+/t18-,21-/m1/s1 |
| InChIKey | OZRBESQLZRLCTM-PLUMIXRBSA-N |
| XLogP | 2.89 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|