C21H21N3O7 — CID 23976344
[(E,1R,2R)-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methoxy-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23976344) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is [(E,1R,2R)-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methoxy-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methoxy-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23976344 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [(E,1R,2R)-5-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-2-methoxy-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc(C#N)cc2)[C@@H](/C=C/C(=O)NO)OC)cc1O |
| InChI | InChI=1S/C21H21N3O7/c1-29-17-8-5-14(11-16(17)25)20(18(30-2)9-10-19(26)24-28)31-21(27)23-15-6-3-13(12-22)4-7-15/h3-11,18,20,25,28H,1-2H3,(H,23,27)(H,24,26)/b10-9+/t18-,20-/m1/s1 |
| InChIKey | RCZUJHBSTXLRIV-CLKPHGLSSA-N |
| XLogP | 2.64 |
| TPSA | 150.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|