C20H23NO5 — CID 23863411
[(1R,2S)-1-(3-hydroxy-4-methoxyphenyl)-2-methylbut-3-enyl] N-(4-methoxyphenyl)carbamate (PubChem CID 23863411) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [(1R,2S)-1-(3-hydroxy-4-methoxyphenyl)-2-methylbut-3-enyl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(1R,2S)-1-(3-hydroxy-4-methoxyphenyl)-2-methylbut-3-enyl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 23863411 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(1R,2S)-1-(3-hydroxy-4-methoxyphenyl)-2-methylbut-3-enyl] N-(4-methoxyphenyl)carbamate |
| SMILES | C=C[C@H](C)[C@@H](OC(=O)Nc1ccc(OC)cc1)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C20H23NO5/c1-5-13(2)19(14-6-11-18(25-4)17(22)12-14)26-20(23)21-15-7-9-16(24-3)10-8-15/h5-13,19,22H,1H2,2-4H3,(H,21,23)/t13-,19+/m0/s1 |
| InChIKey | YDFRFPLVVSJXOP-ORAYPTAESA-N |
| XLogP | 4.52 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|