C29H29NO8 — CID 23920428
(E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-phenoxyhept-2-enoic acid (PubChem CID 23920428) has the molecular formula C29H29NO8 and a molecular weight of 519.55 g/mol. Its IUPAC name is (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-phenoxyhept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-phenoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23920428 |
| Molecular Formula | C29H29NO8 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-phenoxyhept-2-enoic acid |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc(C(C)=O)cc2)[C@@H](CC/C=C/C(=O)O)Oc2ccccc2)cc1O |
| InChI | InChI=1S/C29H29NO8/c1-19(31)20-12-15-22(16-13-20)30-29(35)38-28(21-14-17-25(36-2)24(32)18-21)26(10-6-7-11-27(33)34)37-23-8-4-3-5-9-23/h3-5,7-9,11-18,26,28,32H,6,10H2,1-2H3,(H,30,35)(H,33,34)/b11-7+/t26-,28-/m1/s1 |
| InChIKey | VLKOKEQJBOTLTB-OMVZNQHCSA-N |
| XLogP | 5.76 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|