C23H27BrN2O7 — CID 23778652
[(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23778652) has the molecular formula C23H27BrN2O7 and a molecular weight of 523.38 g/mol. Its IUPAC name is [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23778652 |
| Molecular Formula | C23H27BrN2O7 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(3-hydroxy-4-methoxyphenyl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CCO[C@@H](CC/C=C/C(=O)NO)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C23H27BrN2O7/c1-3-32-20(6-4-5-7-21(28)26-30)22(15-8-13-19(31-2)18(27)14-15)33-23(29)25-17-11-9-16(24)10-12-17/h5,7-14,20,22,27,30H,3-4,6H2,1-2H3,(H,25,29)(H,26,28)/b7-5+/t20-,22-/m0/s1 |
| InChIKey | RGCSDHRRLYSWSN-HKRUVYOCSA-N |
| XLogP | 4.70 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|