C26H25BrN2O6 — CID 23749957
[(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23749957) has the molecular formula C26H25BrN2O6 and a molecular weight of 541.40 g/mol. Its IUPAC name is [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23749957 |
| Molecular Formula | C26H25BrN2O6 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | O=C(/C=C/CC[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)cc1)NO |
| InChI | InChI=1S/C26H25BrN2O6/c27-19-12-14-20(15-13-19)28-26(32)35-25(18-10-16-21(30)17-11-18)23(8-4-5-9-24(31)29-33)34-22-6-2-1-3-7-22/h1-3,5-7,9-17,23,25,30,33H,4,8H2,(H,28,32)(H,29,31)/b9-5+/t23-,25-/m0/s1 |
| InChIKey | MYAMKYHQRLFDJZ-AYSVDFJMSA-N |
| XLogP | 5.73 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|