C30H27BrN2O6 — CID 23948357
[(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23948357) has the molecular formula C30H27BrN2O6 and a molecular weight of 591.46 g/mol. Its IUPAC name is [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23948357 |
| Molecular Formula | C30H27BrN2O6 |
| Molecular Weight | 591.46 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | [(E,1S,2S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | O=C(/C=C/CC[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)c2ccccc12)NO |
| InChI | InChI=1S/C30H27BrN2O6/c31-20-14-16-21(17-15-20)32-30(36)39-29(25-18-19-26(34)24-11-5-4-10-23(24)25)27(12-6-7-13-28(35)33-37)38-22-8-2-1-3-9-22/h1-5,7-11,13-19,27,29,34,37H,6,12H2,(H,32,36)(H,33,35)/b13-7+/t27-,29-/m0/s1 |
| InChIKey | RVFPSQXRKCSCRD-RZYALVNYSA-N |
| XLogP | 6.89 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|