C28H29NO7 — CID 23864618
(E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-6-ethoxy-7-(4-hydroxynaphthalen-1-yl)hept-2-enoic acid (PubChem CID 23864618) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-6-ethoxy-7-(4-hydroxynaphthalen-1-yl)hept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-6-ethoxy-7-(4-hydroxynaphthalen-1-yl)hept-2-enoic acid |
|---|---|
| PubChem CID | 23864618 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (E,6R,7R)-7-[(4-acetylphenyl)carbamoyloxy]-6-ethoxy-7-(4-hydroxynaphthalen-1-yl)hept-2-enoic acid |
| SMILES | CCO[C@H](CC/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C28H29NO7/c1-3-35-25(10-6-7-11-26(32)33)27(23-16-17-24(31)22-9-5-4-8-21(22)23)36-28(34)29-20-14-12-19(13-15-20)18(2)30/h4-5,7-9,11-17,25,27,31H,3,6,10H2,1-2H3,(H,29,34)(H,32,33)/b11-7+/t25-,27-/m1/s1 |
| InChIKey | WMJPWMZXBKDWCY-ITMHKMNPSA-N |
| XLogP | 5.86 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|