C26H27BrN2O6 — CID 23749651
[(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23749651) has the molecular formula C26H27BrN2O6 and a molecular weight of 543.41 g/mol. Its IUPAC name is [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23749651 |
| Molecular Formula | C26H27BrN2O6 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | [(E,1S,2S)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CCO[C@@H](CC/C=C/C(=O)NO)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C26H27BrN2O6/c1-2-34-23(9-5-6-10-24(31)29-33)25(35-26(32)28-18-13-11-17(27)12-14-18)21-15-16-22(30)20-8-4-3-7-19(20)21/h3-4,6-8,10-16,23,25,30,33H,2,5,9H2,1H3,(H,28,32)(H,29,31)/b10-6+/t23-,25-/m0/s1 |
| InChIKey | HAHUWLDSARDYOX-ADSWJOHSSA-N |
| XLogP | 5.84 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|