C26H25N3O5 — CID 23778666
[(E,1S,2R)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23778666) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(E,1S,2R)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1S,2R)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23778666 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [(E,1S,2R)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | C[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C26H25N3O5/c1-17(6-2-5-9-24(31)29-33)25(22-14-15-23(30)21-8-4-3-7-20(21)22)34-26(32)28-19-12-10-18(16-27)11-13-19/h3-5,7-15,17,25,30,33H,2,6H2,1H3,(H,28,32)(H,29,31)/b9-5+/t17-,25+/m1/s1 |
| InChIKey | MZTRRMSUSIASRF-CZSCLNQJSA-N |
| XLogP | 5.18 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|