C22H21BrN2O6 — CID 23892565
(E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-[(4-cyanophenyl)carbamoyloxy]-6-methoxyhept-2-enoic acid (PubChem CID 23892565) has the molecular formula C22H21BrN2O6 and a molecular weight of 489.32 g/mol. Its IUPAC name is (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-[(4-cyanophenyl)carbamoyloxy]-6-methoxyhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-[(4-cyanophenyl)carbamoyloxy]-6-methoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23892565 |
| Molecular Formula | C22H21BrN2O6 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-[(4-cyanophenyl)carbamoyloxy]-6-methoxyhept-2-enoic acid |
| SMILES | CO[C@@H](CC/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C22H21BrN2O6/c1-30-19(4-2-3-5-20(27)28)21(17-12-15(23)8-11-18(17)26)31-22(29)25-16-9-6-14(13-24)7-10-16/h3,5-12,19,21,26H,2,4H2,1H3,(H,25,29)(H,27,28)/b5-3+/t19-,21-/m0/s1 |
| InChIKey | DTRKSBHUNBMENT-UEDNFGOZSA-N |
| XLogP | 4.75 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|