C22H24BrNO5S — CID 23778836
(E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-6-methyl-7-[(4-methylsulfanylphenyl)carbamoyloxy]hept-2-enoic acid (PubChem CID 23778836) has the molecular formula C22H24BrNO5S and a molecular weight of 494.41 g/mol. Its IUPAC name is (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-6-methyl-7-[(4-methylsulfanylphenyl)carbamoyloxy]hept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-6-methyl-7-[(4-methylsulfanylphenyl)carbamoyloxy]hept-2-enoic acid |
|---|---|
| PubChem CID | 23778836 |
| Molecular Formula | C22H24BrNO5S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-6-methyl-7-[(4-methylsulfanylphenyl)carbamoyloxy]hept-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2cc(Br)ccc2O)[C@H](C)CC/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C22H24BrNO5S/c1-14(5-3-4-6-20(26)27)21(18-13-15(23)7-12-19(18)25)29-22(28)24-16-8-10-17(30-2)11-9-16/h4,6-14,21,25H,3,5H2,1-2H3,(H,24,28)(H,26,27)/b6-4+/t14-,21-/m1/s1 |
| InChIKey | KGXXPSZPNPYXGZ-CALCMETGSA-N |
| XLogP | 6.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|