C22H25IN2O5S — CID 23836558
[(E,1R,2R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23836558) has the molecular formula C22H25IN2O5S and a molecular weight of 556.42 g/mol. Its IUPAC name is [(E,1R,2R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23836558 |
| Molecular Formula | C22H25IN2O5S |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | [(E,1R,2R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2cc(I)ccc2O)[C@H](C)CC/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C22H25IN2O5S/c1-14(5-3-4-6-20(27)25-29)21(18-13-15(23)7-12-19(18)26)30-22(28)24-16-8-10-17(31-2)11-9-16/h4,6-14,21,26,29H,3,5H2,1-2H3,(H,24,28)(H,25,27)/b6-4+/t14-,21-/m1/s1 |
| InChIKey | FRECEVJOXTUPBD-CALCMETGSA-N |
| XLogP | 5.49 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|