C20H21IN2O5S — CID 23749803
[(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23749803) has the molecular formula C20H21IN2O5S and a molecular weight of 528.37 g/mol. Its IUPAC name is [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23749803 |
| Molecular Formula | C20H21IN2O5S |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2cc(I)ccc2O)[C@@H](C)/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C20H21IN2O5S/c1-12(3-10-18(25)23-27)19(16-11-13(21)4-9-17(16)24)28-20(26)22-14-5-7-15(29-2)8-6-14/h3-12,19,24,27H,1-2H3,(H,22,26)(H,23,25)/b10-3+/t12-,19-/m0/s1 |
| InChIKey | NHODDIWDBNJNKR-ZVAPUPAPSA-N |
| XLogP | 4.71 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|