C20H20INO5 — CID 23807868
(E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-[(4-methylphenyl)carbamoyloxy]pent-2-enoic acid (PubChem CID 23807868) has the molecular formula C20H20INO5 and a molecular weight of 481.29 g/mol. Its IUPAC name is (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-[(4-methylphenyl)carbamoyloxy]pent-2-enoic acid.
| Compound Name | (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-[(4-methylphenyl)carbamoyloxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 23807868 |
| Molecular Formula | C20H20INO5 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-[(4-methylphenyl)carbamoyloxy]pent-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)O[C@H](c2cc(I)ccc2O)[C@H](C)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C20H20INO5/c1-12-3-7-15(8-4-12)22-20(26)27-19(13(2)5-10-18(24)25)16-11-14(21)6-9-17(16)23/h3-11,13,19,23H,1-2H3,(H,22,26)(H,24,25)/b10-5+/t13-,19+/m1/s1 |
| InChIKey | KMCQIYWITRJFAS-SYEASQGXSA-N |
| XLogP | 4.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|