C27H26IN3O5 — CID 23778902
[(E,1R,2S)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23778902) has the molecular formula C27H26IN3O5 and a molecular weight of 599.43 g/mol. Its IUPAC name is [(E,1R,2S)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2S)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23778902 |
| Molecular Formula | C27H26IN3O5 |
| Molecular Weight | 599.43 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | [(E,1R,2S)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](c2cc(I)ccc2O)[C@@H](C)/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C27H26IN3O5/c1-16(7-14-25(34)31-23-6-4-3-5-22(23)29)26(21-15-19(28)10-13-24(21)33)36-27(35)30-20-11-8-18(9-12-20)17(2)32/h3-16,26,33H,29H2,1-2H3,(H,30,35)(H,31,34)/b14-7+/t16-,26+/m0/s1 |
| InChIKey | MSJZSMRLRSGOIN-YHJQGBBDSA-N |
| XLogP | 5.90 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|